About (E)-3-methoxyprop-2-enoic acid;2-(2-methylsulfanyl-1,3-thiazol-4-yl)-6H-1-benzofuran-7-one
(E)-3-methoxyprop-2-enoic acid;2-(2-methylsulfanyl-1,3-thiazol-4-yl)-6H-1-benzofuran-7-one (PubChem CID 67834287) has the molecular formula C16H15NO5S2
and a molecular weight of 365.43 g/mol. Its IUPAC name is (E)-3-methoxyprop-2-enoic acid;2-(2-methylsulfanyl-1,3-thiazol-4-yl)-6H-1-benzofuran-7-one.
Molecular Properties
| Compound Name | (E)-3-methoxyprop-2-enoic acid;2-(2-methylsulfanyl-1,3-thiazol-4-yl)-6H-1-benzofuran-7-one |
| PubChem CID | 67834287 |
| Molecular Formula | C16H15NO5S2 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.04 |
| IUPAC Name | (E)-3-methoxyprop-2-enoic acid;2-(2-methylsulfanyl-1,3-thiazol-4-yl)-6H-1-benzofuran-7-one |
| SMILES | CO/C=C/C(=O)O.CSc1nc(-c2cc3c(o2)C(=O)CC=C3)cs1 |
| InChI | InChI=1S/C12H9NO2S2.C4H6O3/c1-16-12-13-8(6-17-12)10-5-7-3-2-4-9(14)11(7)15-10;1-7-3-2-4(5)6/h2-3,5-6H,4H2,1H3;2-3H,1H3,(H,5,6)/b;3-2+ |
| InChIKey | OEAWOIZGRNKLDR-ZPYUXNTASA-N |
| XLogP | 3.96 |
| TPSA | 89.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-3-methoxyprop-2-enoic acid;2-(2-methylsulfanyl-1,3-thiazol-4-yl)-6H-1-benzofuran-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-3-methoxyprop-2-enoic acid;2-(2-methylsulfanyl-1,3-thiazol-4-yl)-6H-1-benzofuran-7-one?
The IUPAC name of (E)-3-methoxyprop-2-enoic acid;2-(2-methylsulfanyl-1,3-thiazol-4-yl)-6H-1-benzofuran-7-one (CID 67834287) is (E)-3-methoxyprop-2-enoic acid;2-(2-methylsulfanyl-1,3-thiazol-4-yl)-6H-1-benzofuran-7-one.
What is the SMILES notation for (E)-3-methoxyprop-2-enoic acid;2-(2-methylsulfanyl-1,3-thiazol-4-yl)-6H-1-benzofuran-7-one?
The canonical SMILES for (E)-3-methoxyprop-2-enoic acid;2-(2-methylsulfanyl-1,3-thiazol-4-yl)-6H-1-benzofuran-7-one is CO/C=C/C(=O)O.CSc1nc(-c2cc3c(o2)C(=O)CC=C3)cs1.
What is the InChIKey of (E)-3-methoxyprop-2-enoic acid;2-(2-methylsulfanyl-1,3-thiazol-4-yl)-6H-1-benzofuran-7-one?
The InChIKey is OEAWOIZGRNKLDR-ZPYUXNTASA-N. The full InChI is InChI=1S/C12H9NO2S2.C4H6O3/c1-16-12-13-8(6-17-12)10-5-7-3-2-4-9(14)11(7)15-10;1-7-3-2-4(5)6/h2-3,5-6H,4H2,1H3;2-3H,1H3,(H,5,6)/b;3-2+.
What are the key properties of (E)-3-methoxyprop-2-enoic acid;2-(2-methylsulfanyl-1,3-thiazol-4-yl)-6H-1-benzofuran-7-one?
(E)-3-methoxyprop-2-enoic acid;2-(2-methylsulfanyl-1,3-thiazol-4-yl)-6H-1-benzofuran-7-one has a molecular weight of 365.43 g/mol, XLogP of 3.96, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-3-methoxyprop-2-enoic acid;2-(2-methylsulfanyl-1,3-thiazol-4-yl)-6H-1-benzofuran-7-one is sourced from PubChem (CID 67834287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).