About 8-[3-[(2S,4R)-4-methoxy-2-methyloxan-4-yl]phenyl]sulfanyl-1-methylquinolin-2-one
8-[3-[(2S,4R)-4-methoxy-2-methyloxan-4-yl]phenyl]sulfanyl-1-methylquinolin-2-one (PubChem CID 67834589) has the molecular formula C23H25NO3S
and a molecular weight of 395.52 g/mol. Its IUPAC name is 8-[3-[(2S,4R)-4-methoxy-2-methyloxan-4-yl]phenyl]sulfanyl-1-methylquinolin-2-one.
Molecular Properties
| Compound Name | 8-[3-[(2S,4R)-4-methoxy-2-methyloxan-4-yl]phenyl]sulfanyl-1-methylquinolin-2-one |
| PubChem CID | 67834589 |
| Molecular Formula | C23H25NO3S |
| Molecular Weight | 395.52 g/mol |
| Exact Mass | 395.16 |
| IUPAC Name | 8-[3-[(2S,4R)-4-methoxy-2-methyloxan-4-yl]phenyl]sulfanyl-1-methylquinolin-2-one |
| SMILES | CO[C@]1(c2cccc(Sc3cccc4ccc(=O)n(C)c34)c2)CCO[C@@H](C)C1 |
| InChI | InChI=1S/C23H25NO3S/c1-16-15-23(26-3,12-13-27-16)18-7-5-8-19(14-18)28-20-9-4-6-17-10-11-21(25)24(2)22(17)20/h4-11,14,16H,12-13,15H2,1-3H3/t16-,23+/m0/s1 |
| InChIKey | FMBJRNPCXCCNFF-QMHKHESXSA-N |
| XLogP | 4.73 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.52 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 8-[3-[(2S,4R)-4-methoxy-2-methyloxan-4-yl]phenyl]sulfanyl-1-methylquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[3-[(2S,4R)-4-methoxy-2-methyloxan-4-yl]phenyl]sulfanyl-1-methylquinolin-2-one?
The IUPAC name of 8-[3-[(2S,4R)-4-methoxy-2-methyloxan-4-yl]phenyl]sulfanyl-1-methylquinolin-2-one (CID 67834589) is 8-[3-[(2S,4R)-4-methoxy-2-methyloxan-4-yl]phenyl]sulfanyl-1-methylquinolin-2-one.
What is the SMILES notation for 8-[3-[(2S,4R)-4-methoxy-2-methyloxan-4-yl]phenyl]sulfanyl-1-methylquinolin-2-one?
The canonical SMILES for 8-[3-[(2S,4R)-4-methoxy-2-methyloxan-4-yl]phenyl]sulfanyl-1-methylquinolin-2-one is CO[C@]1(c2cccc(Sc3cccc4ccc(=O)n(C)c34)c2)CCO[C@@H](C)C1.
What is the InChIKey of 8-[3-[(2S,4R)-4-methoxy-2-methyloxan-4-yl]phenyl]sulfanyl-1-methylquinolin-2-one?
The InChIKey is FMBJRNPCXCCNFF-QMHKHESXSA-N. The full InChI is InChI=1S/C23H25NO3S/c1-16-15-23(26-3,12-13-27-16)18-7-5-8-19(14-18)28-20-9-4-6-17-10-11-21(25)24(2)22(17)20/h4-11,14,16H,12-13,15H2,1-3H3/t16-,23+/m0/s1.
What are the key properties of 8-[3-[(2S,4R)-4-methoxy-2-methyloxan-4-yl]phenyl]sulfanyl-1-methylquinolin-2-one?
8-[3-[(2S,4R)-4-methoxy-2-methyloxan-4-yl]phenyl]sulfanyl-1-methylquinolin-2-one has a molecular weight of 395.52 g/mol, XLogP of 4.73, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[3-[(2S,4R)-4-methoxy-2-methyloxan-4-yl]phenyl]sulfanyl-1-methylquinolin-2-one is sourced from PubChem (CID 67834589), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).