About spiro[1H-2-benzofuran-3,3'-piperidine]
spiro[1H-2-benzofuran-3,3'-piperidine] (PubChem CID 67834625) has the molecular formula C12H15NO
and a molecular weight of 189.26 g/mol. Its IUPAC name is spiro[1H-2-benzofuran-3,3'-piperidine].
Molecular Properties
| Compound Name | spiro[1H-2-benzofuran-3,3'-piperidine] |
| PubChem CID | 67834625 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | spiro[1H-2-benzofuran-3,3'-piperidine] |
| SMILES | c1ccc2c(c1)COC21CCCNC1 |
| InChI | InChI=1S/C12H15NO/c1-2-5-11-10(4-1)8-14-12(11)6-3-7-13-9-12/h1-2,4-5,13H,3,6-9H2 |
| InChIKey | KCAMDBNDUHBEBH-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze spiro[1H-2-benzofuran-3,3'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of spiro[1H-2-benzofuran-3,3'-piperidine]?
The IUPAC name of spiro[1H-2-benzofuran-3,3'-piperidine] (CID 67834625) is spiro[1H-2-benzofuran-3,3'-piperidine].
What is the SMILES notation for spiro[1H-2-benzofuran-3,3'-piperidine]?
The canonical SMILES for spiro[1H-2-benzofuran-3,3'-piperidine] is c1ccc2c(c1)COC21CCCNC1.
What is the InChIKey of spiro[1H-2-benzofuran-3,3'-piperidine]?
The InChIKey is KCAMDBNDUHBEBH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO/c1-2-5-11-10(4-1)8-14-12(11)6-3-7-13-9-12/h1-2,4-5,13H,3,6-9H2.
What are the key properties of spiro[1H-2-benzofuran-3,3'-piperidine]?
spiro[1H-2-benzofuran-3,3'-piperidine] has a molecular weight of 189.26 g/mol, XLogP of 1.80, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for spiro[1H-2-benzofuran-3,3'-piperidine] is sourced from PubChem (CID 67834625), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).