About 11-[[(2S)-pyrrolidin-2-yl]methyl]-6H-benzo[c][1,5]benzothiazepine;hydrochloride
11-[[(2S)-pyrrolidin-2-yl]methyl]-6H-benzo[c][1,5]benzothiazepine;hydrochloride (PubChem CID 67834687) has the molecular formula C18H21ClN2S
and a molecular weight of 332.90 g/mol. Its IUPAC name is 11-[[(2S)-pyrrolidin-2-yl]methyl]-6H-benzo[c][1,5]benzothiazepine;hydrochloride.
Molecular Properties
| Compound Name | 11-[[(2S)-pyrrolidin-2-yl]methyl]-6H-benzo[c][1,5]benzothiazepine;hydrochloride |
| PubChem CID | 67834687 |
| Molecular Formula | C18H21ClN2S |
| Molecular Weight | 332.90 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 11-[[(2S)-pyrrolidin-2-yl]methyl]-6H-benzo[c][1,5]benzothiazepine;hydrochloride |
| SMILES | Cl.c1ccc2c(c1)CSc1ccccc1N2C[C@@H]1CCCN1 |
| InChI | InChI=1S/C18H20N2S.ClH/c1-2-8-16-14(6-1)13-21-18-10-4-3-9-17(18)20(16)12-15-7-5-11-19-15;/h1-4,6,8-10,15,19H,5,7,11-13H2;1H/t15-;/m0./s1 |
| InChIKey | CQFYCOFFLXEYLR-RSAXXLAASA-N |
| XLogP | 4.60 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.90 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 11-[[(2S)-pyrrolidin-2-yl]methyl]-6H-benzo[c][1,5]benzothiazepine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-[[(2S)-pyrrolidin-2-yl]methyl]-6H-benzo[c][1,5]benzothiazepine;hydrochloride?
The IUPAC name of 11-[[(2S)-pyrrolidin-2-yl]methyl]-6H-benzo[c][1,5]benzothiazepine;hydrochloride (CID 67834687) is 11-[[(2S)-pyrrolidin-2-yl]methyl]-6H-benzo[c][1,5]benzothiazepine;hydrochloride.
What is the SMILES notation for 11-[[(2S)-pyrrolidin-2-yl]methyl]-6H-benzo[c][1,5]benzothiazepine;hydrochloride?
The canonical SMILES for 11-[[(2S)-pyrrolidin-2-yl]methyl]-6H-benzo[c][1,5]benzothiazepine;hydrochloride is Cl.c1ccc2c(c1)CSc1ccccc1N2C[C@@H]1CCCN1.
What is the InChIKey of 11-[[(2S)-pyrrolidin-2-yl]methyl]-6H-benzo[c][1,5]benzothiazepine;hydrochloride?
The InChIKey is CQFYCOFFLXEYLR-RSAXXLAASA-N. The full InChI is InChI=1S/C18H20N2S.ClH/c1-2-8-16-14(6-1)13-21-18-10-4-3-9-17(18)20(16)12-15-7-5-11-19-15;/h1-4,6,8-10,15,19H,5,7,11-13H2;1H/t15-;/m0./s1.
What are the key properties of 11-[[(2S)-pyrrolidin-2-yl]methyl]-6H-benzo[c][1,5]benzothiazepine;hydrochloride?
11-[[(2S)-pyrrolidin-2-yl]methyl]-6H-benzo[c][1,5]benzothiazepine;hydrochloride has a molecular weight of 332.90 g/mol, XLogP of 4.60, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 11-[[(2S)-pyrrolidin-2-yl]methyl]-6H-benzo[c][1,5]benzothiazepine;hydrochloride is sourced from PubChem (CID 67834687), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).