C21H30F3N5O4 — CID 67834697
2-[4-[4-(4-carbamimidoylphenyl)-2-methylpiperazin-1-yl]piperidin-1-yl]acetic acid;2,2,2-trifluoroacetic acid (PubChem CID 67834697) has the molecular formula C21H30F3N5O4 and a molecular weight of 473.50 g/mol. Its IUPAC name is 2-[4-[4-(4-carbamimidoylphenyl)-2-methylpiperazin-1-yl]piperidin-1-yl]acetic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 2-[4-[4-(4-carbamimidoylphenyl)-2-methylpiperazin-1-yl]piperidin-1-yl]acetic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 67834697 |
| Molecular Formula | C21H30F3N5O4 |
| Molecular Weight | 473.50 g/mol |
| Exact Mass | 473.22 |
| IUPAC Name | 2-[4-[4-(4-carbamimidoylphenyl)-2-methylpiperazin-1-yl]piperidin-1-yl]acetic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(N2CCN(C3CCN(CC(=O)O)CC3)C(C)C2)cc1 |
| InChI | InChI=1S/C19H29N5O2.C2HF3O2/c1-14-12-23(16-4-2-15(3-5-16)19(20)21)10-11-24(14)17-6-8-22(9-7-17)13-18(25)26;3-2(4,5)1(6)7/h2-5,14,17H,6-13H2,1H3,(H3,20,21)(H,25,26);(H,6,7) |
| InChIKey | QDIYVUPEISSKRH-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 134.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.50 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|