C27H37NO3Si — CID 67835020
(3S,4S)-1-[tert-butyl(dimethyl)silyl]-4-[(3S)-5,5-diphenyloxolan-3-yl]-3-[(1S)-1-hydroxyethyl]azetidin-2-one (PubChem CID 67835020) has the molecular formula C27H37NO3Si and a molecular weight of 451.68 g/mol. Its IUPAC name is (3S,4S)-1-[tert-butyl(dimethyl)silyl]-4-[(3S)-5,5-diphenyloxolan-3-yl]-3-[(1S)-1-hydroxyethyl]azetidin-2-one.
| Compound Name | (3S,4S)-1-[tert-butyl(dimethyl)silyl]-4-[(3S)-5,5-diphenyloxolan-3-yl]-3-[(1S)-1-hydroxyethyl]azetidin-2-one |
|---|---|
| PubChem CID | 67835020 |
| Molecular Formula | C27H37NO3Si |
| Molecular Weight | 451.68 g/mol |
| Exact Mass | 451.25 |
| IUPAC Name | (3S,4S)-1-[tert-butyl(dimethyl)silyl]-4-[(3S)-5,5-diphenyloxolan-3-yl]-3-[(1S)-1-hydroxyethyl]azetidin-2-one |
| SMILES | C[C@H](O)[C@H]1C(=O)N([Si](C)(C)C(C)(C)C)[C@H]1[C@H]1COC(c2ccccc2)(c2ccccc2)C1 |
| InChI | InChI=1S/C27H37NO3Si/c1-19(29)23-24(28(25(23)30)32(5,6)26(2,3)4)20-17-27(31-18-20,21-13-9-7-10-14-21)22-15-11-8-12-16-22/h7-16,19-20,23-24,29H,17-18H2,1-6H3/t19-,20+,23+,24-/m0/s1 |
| InChIKey | SUZVCHFJQHJNGL-TYJFDUFHSA-N |
| XLogP | 5.18 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.68 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|