C21H27ClN4O2 — CID 67835051
1-[2-[5-(4-chlorophenyl)furan-2-yl]ethylideneamino]-3-[4-(dimethylamino)butyl]imidazolidin-2-one (PubChem CID 67835051) has the molecular formula C21H27ClN4O2 and a molecular weight of 402.93 g/mol. Its IUPAC name is 1-[2-[5-(4-chlorophenyl)furan-2-yl]ethylideneamino]-3-[4-(dimethylamino)butyl]imidazolidin-2-one.
| Compound Name | 1-[2-[5-(4-chlorophenyl)furan-2-yl]ethylideneamino]-3-[4-(dimethylamino)butyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 67835051 |
| Molecular Formula | C21H27ClN4O2 |
| Molecular Weight | 402.93 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 1-[2-[5-(4-chlorophenyl)furan-2-yl]ethylideneamino]-3-[4-(dimethylamino)butyl]imidazolidin-2-one |
| SMILES | CN(C)CCCCN1CCN(N=CCc2ccc(-c3ccc(Cl)cc3)o2)C1=O |
| InChI | InChI=1S/C21H27ClN4O2/c1-24(2)13-3-4-14-25-15-16-26(21(25)27)23-12-11-19-9-10-20(28-19)17-5-7-18(22)8-6-17/h5-10,12H,3-4,11,13-16H2,1-2H3 |
| InChIKey | HPMWPBWLYBPWHG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 52.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.93 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|