C18H23NO5 — CID 67835698
(3S,4S)-3-acetyl-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[methoxy(phenyl)methyl]azetidin-2-one (PubChem CID 67835698) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is (3S,4S)-3-acetyl-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[methoxy(phenyl)methyl]azetidin-2-one.
| Compound Name | (3S,4S)-3-acetyl-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[methoxy(phenyl)methyl]azetidin-2-one |
|---|---|
| PubChem CID | 67835698 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (3S,4S)-3-acetyl-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-1-[methoxy(phenyl)methyl]azetidin-2-one |
| SMILES | COC(c1ccccc1)N1C(=O)[C@H](C(C)=O)[C@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C18H23NO5/c1-11(20)14-15(13-10-23-18(2,3)24-13)19(16(14)21)17(22-4)12-8-6-5-7-9-12/h5-9,13-15,17H,10H2,1-4H3/t13-,14-,15-,17?/m1/s1 |
| InChIKey | JOBHSLUQAFUAIQ-BOEXNKMNSA-N |
| XLogP | 1.90 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|