About 2-amino-N,4-diphenyl-1,3-thiazole-5-carboxamide
2-amino-N,4-diphenyl-1,3-thiazole-5-carboxamide (PubChem CID 678358) has the molecular formula C16H13N3OS
and a molecular weight of 295.37 g/mol. Its IUPAC name is 2-amino-N,4-diphenyl-1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 2-amino-N,4-diphenyl-1,3-thiazole-5-carboxamide |
| PubChem CID | 678358 |
| Molecular Formula | C16H13N3OS |
| Molecular Weight | 295.37 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 2-amino-N,4-diphenyl-1,3-thiazole-5-carboxamide |
| SMILES | Nc1nc(-c2ccccc2)c(C(=O)Nc2ccccc2)s1 |
| InChI | InChI=1S/C16H13N3OS/c17-16-19-13(11-7-3-1-4-8-11)14(21-16)15(20)18-12-9-5-2-6-10-12/h1-10H,(H2,17,19)(H,18,20) |
| InChIKey | USJJTZJZWYSQRZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.37 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-N,4-diphenyl-1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-N,4-diphenyl-1,3-thiazole-5-carboxamide?
The IUPAC name of 2-amino-N,4-diphenyl-1,3-thiazole-5-carboxamide (CID 678358) is 2-amino-N,4-diphenyl-1,3-thiazole-5-carboxamide.
What is the SMILES notation for 2-amino-N,4-diphenyl-1,3-thiazole-5-carboxamide?
The canonical SMILES for 2-amino-N,4-diphenyl-1,3-thiazole-5-carboxamide is Nc1nc(-c2ccccc2)c(C(=O)Nc2ccccc2)s1.
What is the InChIKey of 2-amino-N,4-diphenyl-1,3-thiazole-5-carboxamide?
The InChIKey is USJJTZJZWYSQRZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N3OS/c17-16-19-13(11-7-3-1-4-8-11)14(21-16)15(20)18-12-9-5-2-6-10-12/h1-10H,(H2,17,19)(H,18,20).
What are the key properties of 2-amino-N,4-diphenyl-1,3-thiazole-5-carboxamide?
2-amino-N,4-diphenyl-1,3-thiazole-5-carboxamide has a molecular weight of 295.37 g/mol, XLogP of 3.64, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-N,4-diphenyl-1,3-thiazole-5-carboxamide is sourced from PubChem (CID 678358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).