C14H23Cl2N5O4 — CID 67835919
2-[[6-(4-methyl-1,4-diazepan-1-yl)pyridine-3-carbonyl]amino]ethyl nitrate;dihydrochloride (PubChem CID 67835919) has the molecular formula C14H23Cl2N5O4 and a molecular weight of 396.28 g/mol. Its IUPAC name is 2-[[6-(4-methyl-1,4-diazepan-1-yl)pyridine-3-carbonyl]amino]ethyl nitrate;dihydrochloride.
| Compound Name | 2-[[6-(4-methyl-1,4-diazepan-1-yl)pyridine-3-carbonyl]amino]ethyl nitrate;dihydrochloride |
|---|---|
| PubChem CID | 67835919 |
| Molecular Formula | C14H23Cl2N5O4 |
| Molecular Weight | 396.28 g/mol |
| Exact Mass | 395.11 |
| IUPAC Name | 2-[[6-(4-methyl-1,4-diazepan-1-yl)pyridine-3-carbonyl]amino]ethyl nitrate;dihydrochloride |
| SMILES | CN1CCCN(c2ccc(C(=O)NCCO[N+](=O)[O-])cn2)CC1.Cl.Cl |
| InChI | InChI=1S/C14H21N5O4.2ClH/c1-17-6-2-7-18(9-8-17)13-4-3-12(11-16-13)14(20)15-5-10-23-19(21)22;;/h3-4,11H,2,5-10H2,1H3,(H,15,20);2*1H |
| InChIKey | BGKSZHDDJVGJDF-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 100.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.28 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|