About 4-N-[4-(cyclohexylmethoxy)phenyl]-2-methylquinoline-4,8-diamine;hydrate;hydrochloride
4-N-[4-(cyclohexylmethoxy)phenyl]-2-methylquinoline-4,8-diamine;hydrate;hydrochloride (PubChem CID 67836104) has the molecular formula C23H30ClN3O2
and a molecular weight of 415.97 g/mol. Its IUPAC name is 4-N-[4-(cyclohexylmethoxy)phenyl]-2-methylquinoline-4,8-diamine;hydrate;hydrochloride.
Molecular Properties
| Compound Name | 4-N-[4-(cyclohexylmethoxy)phenyl]-2-methylquinoline-4,8-diamine;hydrate;hydrochloride |
| PubChem CID | 67836104 |
| Molecular Formula | C23H30ClN3O2 |
| Molecular Weight | 415.97 g/mol |
| Exact Mass | 415.20 |
| IUPAC Name | 4-N-[4-(cyclohexylmethoxy)phenyl]-2-methylquinoline-4,8-diamine;hydrate;hydrochloride |
| SMILES | Cc1cc(Nc2ccc(OCC3CCCCC3)cc2)c2cccc(N)c2n1.Cl.O |
| InChI | InChI=1S/C23H27N3O.ClH.H2O/c1-16-14-22(20-8-5-9-21(24)23(20)25-16)26-18-10-12-19(13-11-18)27-15-17-6-3-2-4-7-17;;/h5,8-14,17H,2-4,6-7,15,24H2,1H3,(H,25,26);1H;1H2 |
| InChIKey | NTUNNPQOCRQYNZ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 415.97 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-N-[4-(cyclohexylmethoxy)phenyl]-2-methylquinoline-4,8-diamine;hydrate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-N-[4-(cyclohexylmethoxy)phenyl]-2-methylquinoline-4,8-diamine;hydrate;hydrochloride?
The IUPAC name of 4-N-[4-(cyclohexylmethoxy)phenyl]-2-methylquinoline-4,8-diamine;hydrate;hydrochloride (CID 67836104) is 4-N-[4-(cyclohexylmethoxy)phenyl]-2-methylquinoline-4,8-diamine;hydrate;hydrochloride.
What is the SMILES notation for 4-N-[4-(cyclohexylmethoxy)phenyl]-2-methylquinoline-4,8-diamine;hydrate;hydrochloride?
The canonical SMILES for 4-N-[4-(cyclohexylmethoxy)phenyl]-2-methylquinoline-4,8-diamine;hydrate;hydrochloride is Cc1cc(Nc2ccc(OCC3CCCCC3)cc2)c2cccc(N)c2n1.Cl.O.
What is the InChIKey of 4-N-[4-(cyclohexylmethoxy)phenyl]-2-methylquinoline-4,8-diamine;hydrate;hydrochloride?
The InChIKey is NTUNNPQOCRQYNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H27N3O.ClH.H2O/c1-16-14-22(20-8-5-9-21(24)23(20)25-16)26-18-10-12-19(13-11-18)27-15-17-6-3-2-4-7-17;;/h5,8-14,17H,2-4,6-7,15,24H2,1H3,(H,25,26);1H;1H2.
What are the key properties of 4-N-[4-(cyclohexylmethoxy)phenyl]-2-methylquinoline-4,8-diamine;hydrate;hydrochloride?
4-N-[4-(cyclohexylmethoxy)phenyl]-2-methylquinoline-4,8-diamine;hydrate;hydrochloride has a molecular weight of 415.97 g/mol, XLogP of 5.43, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-N-[4-(cyclohexylmethoxy)phenyl]-2-methylquinoline-4,8-diamine;hydrate;hydrochloride is sourced from PubChem (CID 67836104), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).