C29H37FN4O2 — CID 67836111
2-[2-[4-[(4-fluorophenyl)-phenylmethylidene]piperidin-1-yl]ethyl]-1-(2-hydroxyethyl)-5,6,7,8,9,9a-hexahydro-[1,2,4]triazolo[4,3-a]azepin-3-one (PubChem CID 67836111) has the molecular formula C29H37FN4O2 and a molecular weight of 492.64 g/mol. Its IUPAC name is 2-[2-[4-[(4-fluorophenyl)-phenylmethylidene]piperidin-1-yl]ethyl]-1-(2-hydroxyethyl)-5,6,7,8,9,9a-hexahydro-[1,2,4]triazolo[4,3-a]azepin-3-one.
| Compound Name | 2-[2-[4-[(4-fluorophenyl)-phenylmethylidene]piperidin-1-yl]ethyl]-1-(2-hydroxyethyl)-5,6,7,8,9,9a-hexahydro-[1,2,4]triazolo[4,3-a]azepin-3-one |
|---|---|
| PubChem CID | 67836111 |
| Molecular Formula | C29H37FN4O2 |
| Molecular Weight | 492.64 g/mol |
| Exact Mass | 492.29 |
| IUPAC Name | 2-[2-[4-[(4-fluorophenyl)-phenylmethylidene]piperidin-1-yl]ethyl]-1-(2-hydroxyethyl)-5,6,7,8,9,9a-hexahydro-[1,2,4]triazolo[4,3-a]azepin-3-one |
| SMILES | O=C1N2CCCCCC2N(CCO)N1CCN1CCC(=C(c2ccccc2)c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C29H37FN4O2/c30-26-12-10-24(11-13-26)28(23-7-3-1-4-8-23)25-14-17-31(18-15-25)19-20-34-29(36)32-16-6-2-5-9-27(32)33(34)21-22-35/h1,3-4,7-8,10-13,27,35H,2,5-6,9,14-22H2 |
| InChIKey | CHZKRCYNXNTSPW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 50.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.64 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |