About 2-[2,2-dimethyl-6-(trifluoromethylsulfonyl)chromen-4-yl]-5-methylphenol
2-[2,2-dimethyl-6-(trifluoromethylsulfonyl)chromen-4-yl]-5-methylphenol (PubChem CID 67836776) has the molecular formula C19H17F3O4S
and a molecular weight of 398.40 g/mol. Its IUPAC name is 2-[2,2-dimethyl-6-(trifluoromethylsulfonyl)chromen-4-yl]-5-methylphenol.
Molecular Properties
| Compound Name | 2-[2,2-dimethyl-6-(trifluoromethylsulfonyl)chromen-4-yl]-5-methylphenol |
| PubChem CID | 67836776 |
| Molecular Formula | C19H17F3O4S |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.08 |
| IUPAC Name | 2-[2,2-dimethyl-6-(trifluoromethylsulfonyl)chromen-4-yl]-5-methylphenol |
| SMILES | Cc1ccc(C2=CC(C)(C)Oc3ccc(S(=O)(=O)C(F)(F)F)cc32)c(O)c1 |
| InChI | InChI=1S/C19H17F3O4S/c1-11-4-6-13(16(23)8-11)15-10-18(2,3)26-17-7-5-12(9-14(15)17)27(24,25)19(20,21)22/h4-10,23H,1-3H3 |
| InChIKey | CWNJBOPNNGKWEO-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[2,2-dimethyl-6-(trifluoromethylsulfonyl)chromen-4-yl]-5-methylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,2-dimethyl-6-(trifluoromethylsulfonyl)chromen-4-yl]-5-methylphenol?
The IUPAC name of 2-[2,2-dimethyl-6-(trifluoromethylsulfonyl)chromen-4-yl]-5-methylphenol (CID 67836776) is 2-[2,2-dimethyl-6-(trifluoromethylsulfonyl)chromen-4-yl]-5-methylphenol.
What is the SMILES notation for 2-[2,2-dimethyl-6-(trifluoromethylsulfonyl)chromen-4-yl]-5-methylphenol?
The canonical SMILES for 2-[2,2-dimethyl-6-(trifluoromethylsulfonyl)chromen-4-yl]-5-methylphenol is Cc1ccc(C2=CC(C)(C)Oc3ccc(S(=O)(=O)C(F)(F)F)cc32)c(O)c1.
What is the InChIKey of 2-[2,2-dimethyl-6-(trifluoromethylsulfonyl)chromen-4-yl]-5-methylphenol?
The InChIKey is CWNJBOPNNGKWEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17F3O4S/c1-11-4-6-13(16(23)8-11)15-10-18(2,3)26-17-7-5-12(9-14(15)17)27(24,25)19(20,21)22/h4-10,23H,1-3H3.
What are the key properties of 2-[2,2-dimethyl-6-(trifluoromethylsulfonyl)chromen-4-yl]-5-methylphenol?
2-[2,2-dimethyl-6-(trifluoromethylsulfonyl)chromen-4-yl]-5-methylphenol has a molecular weight of 398.40 g/mol, XLogP of 4.60, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,2-dimethyl-6-(trifluoromethylsulfonyl)chromen-4-yl]-5-methylphenol is sourced from PubChem (CID 67836776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).