About 3-tert-butyl-1-iodo-2,4-dimethoxybenzene;4-iodo-1,3-benzodioxole
3-tert-butyl-1-iodo-2,4-dimethoxybenzene;4-iodo-1,3-benzodioxole (PubChem CID 67836872) has the molecular formula C19H22I2O4
and a molecular weight of 568.19 g/mol. Its IUPAC name is 3-tert-butyl-1-iodo-2,4-dimethoxybenzene;4-iodo-1,3-benzodioxole.
Molecular Properties
| Compound Name | 3-tert-butyl-1-iodo-2,4-dimethoxybenzene;4-iodo-1,3-benzodioxole |
| PubChem CID | 67836872 |
| Molecular Formula | C19H22I2O4 |
| Molecular Weight | 568.19 g/mol |
| Exact Mass | 567.96 |
| IUPAC Name | 3-tert-butyl-1-iodo-2,4-dimethoxybenzene;4-iodo-1,3-benzodioxole |
| SMILES | COc1ccc(I)c(OC)c1C(C)(C)C.Ic1cccc2c1OCO2 |
| InChI | InChI=1S/C12H17IO2.C7H5IO2/c1-12(2,3)10-9(14-4)7-6-8(13)11(10)15-5;8-5-2-1-3-6-7(5)10-4-9-6/h6-7H,1-5H3;1-3H,4H2 |
| InChIKey | VDLDKDFVLCAVIU-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 568.19 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-tert-butyl-1-iodo-2,4-dimethoxybenzene;4-iodo-1,3-benzodioxole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tert-butyl-1-iodo-2,4-dimethoxybenzene;4-iodo-1,3-benzodioxole?
The IUPAC name of 3-tert-butyl-1-iodo-2,4-dimethoxybenzene;4-iodo-1,3-benzodioxole (CID 67836872) is 3-tert-butyl-1-iodo-2,4-dimethoxybenzene;4-iodo-1,3-benzodioxole.
What is the SMILES notation for 3-tert-butyl-1-iodo-2,4-dimethoxybenzene;4-iodo-1,3-benzodioxole?
The canonical SMILES for 3-tert-butyl-1-iodo-2,4-dimethoxybenzene;4-iodo-1,3-benzodioxole is COc1ccc(I)c(OC)c1C(C)(C)C.Ic1cccc2c1OCO2.
What is the InChIKey of 3-tert-butyl-1-iodo-2,4-dimethoxybenzene;4-iodo-1,3-benzodioxole?
The InChIKey is VDLDKDFVLCAVIU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17IO2.C7H5IO2/c1-12(2,3)10-9(14-4)7-6-8(13)11(10)15-5;8-5-2-1-3-6-7(5)10-4-9-6/h6-7H,1-5H3;1-3H,4H2.
What are the key properties of 3-tert-butyl-1-iodo-2,4-dimethoxybenzene;4-iodo-1,3-benzodioxole?
3-tert-butyl-1-iodo-2,4-dimethoxybenzene;4-iodo-1,3-benzodioxole has a molecular weight of 568.19 g/mol, XLogP of 5.63, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tert-butyl-1-iodo-2,4-dimethoxybenzene;4-iodo-1,3-benzodioxole is sourced from PubChem (CID 67836872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).