C11H11BrN2 — CID 67836980
2-bromo-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazoline (PubChem CID 67836980) has the molecular formula C11H11BrN2 and a molecular weight of 251.13 g/mol. Its IUPAC name is 2-bromo-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazoline.
| Compound Name | 2-bromo-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazoline |
|---|---|
| PubChem CID | 67836980 |
| Molecular Formula | C11H11BrN2 |
| Molecular Weight | 251.13 g/mol |
| Exact Mass | 250.01 |
| IUPAC Name | 2-bromo-1,2,3,3a-tetrahydropyrrolo[2,1-b]quinazoline |
| SMILES | BrC1CC2N=c3ccccc3=CN2C1 |
| InChI | InChI=1S/C11H11BrN2/c12-9-5-11-13-10-4-2-1-3-8(10)6-14(11)7-9/h1-4,6,9,11H,5,7H2 |
| InChIKey | WPGWWLMPCSDEPD-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.13 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|