About N'-(4-amino-3-methylphenyl)-N'-ethylpropane-1-sulfonohydrazide;hydrate
N'-(4-amino-3-methylphenyl)-N'-ethylpropane-1-sulfonohydrazide;hydrate (PubChem CID 67836992) has the molecular formula C12H23N3O3S
and a molecular weight of 289.40 g/mol. Its IUPAC name is N'-(4-amino-3-methylphenyl)-N'-ethylpropane-1-sulfonohydrazide;hydrate.
Molecular Properties
| Compound Name | N'-(4-amino-3-methylphenyl)-N'-ethylpropane-1-sulfonohydrazide;hydrate |
| PubChem CID | 67836992 |
| Molecular Formula | C12H23N3O3S |
| Molecular Weight | 289.40 g/mol |
| Exact Mass | 289.15 |
| IUPAC Name | N'-(4-amino-3-methylphenyl)-N'-ethylpropane-1-sulfonohydrazide;hydrate |
| SMILES | CCCS(=O)(=O)NN(CC)c1ccc(N)c(C)c1.O |
| InChI | InChI=1S/C12H21N3O2S.H2O/c1-4-8-18(16,17)14-15(5-2)11-6-7-12(13)10(3)9-11;/h6-7,9,14H,4-5,8,13H2,1-3H3;1H2 |
| InChIKey | GWCRRLDWJJTDAZ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 106.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.40 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(4-amino-3-methylphenyl)-N'-ethylpropane-1-sulfonohydrazide;hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(4-amino-3-methylphenyl)-N'-ethylpropane-1-sulfonohydrazide;hydrate?
The IUPAC name of N'-(4-amino-3-methylphenyl)-N'-ethylpropane-1-sulfonohydrazide;hydrate (CID 67836992) is N'-(4-amino-3-methylphenyl)-N'-ethylpropane-1-sulfonohydrazide;hydrate.
What is the SMILES notation for N'-(4-amino-3-methylphenyl)-N'-ethylpropane-1-sulfonohydrazide;hydrate?
The canonical SMILES for N'-(4-amino-3-methylphenyl)-N'-ethylpropane-1-sulfonohydrazide;hydrate is CCCS(=O)(=O)NN(CC)c1ccc(N)c(C)c1.O.
What is the InChIKey of N'-(4-amino-3-methylphenyl)-N'-ethylpropane-1-sulfonohydrazide;hydrate?
The InChIKey is GWCRRLDWJJTDAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O2S.H2O/c1-4-8-18(16,17)14-15(5-2)11-6-7-12(13)10(3)9-11;/h6-7,9,14H,4-5,8,13H2,1-3H3;1H2.
What are the key properties of N'-(4-amino-3-methylphenyl)-N'-ethylpropane-1-sulfonohydrazide;hydrate?
N'-(4-amino-3-methylphenyl)-N'-ethylpropane-1-sulfonohydrazide;hydrate has a molecular weight of 289.40 g/mol, XLogP of 0.82, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(4-amino-3-methylphenyl)-N'-ethylpropane-1-sulfonohydrazide;hydrate is sourced from PubChem (CID 67836992), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).