C30H32F2N4O6 — CID 67837005
but-2-enedioic acid;2-[2-[4-(4-fluorobenzoyl)-3-(4-fluorophenyl)piperidin-1-yl]ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one (PubChem CID 67837005) has the molecular formula C30H32F2N4O6 and a molecular weight of 582.60 g/mol. Its IUPAC name is but-2-enedioic acid;2-[2-[4-(4-fluorobenzoyl)-3-(4-fluorophenyl)piperidin-1-yl]ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one.
| Compound Name | but-2-enedioic acid;2-[2-[4-(4-fluorobenzoyl)-3-(4-fluorophenyl)piperidin-1-yl]ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
|---|---|
| PubChem CID | 67837005 |
| Molecular Formula | C30H32F2N4O6 |
| Molecular Weight | 582.60 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | but-2-enedioic acid;2-[2-[4-(4-fluorobenzoyl)-3-(4-fluorophenyl)piperidin-1-yl]ethyl]-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-one |
| SMILES | O=C(O)C=CC(=O)O.O=C(c1ccc(F)cc1)C1CCN(CCn2nc3n(c2=O)CCCC3)CC1c1ccc(F)cc1 |
| InChI | InChI=1S/C26H28F2N4O2.C4H4O4/c27-20-8-4-18(5-9-20)23-17-30(14-12-22(23)25(33)19-6-10-21(28)11-7-19)15-16-32-26(34)31-13-2-1-3-24(31)29-32;5-3(6)1-2-4(7)8/h4-11,22-23H,1-3,12-17H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | KZVXSCMECOCUQS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 134.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.60 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|