C6H6N2O2S — CID 67837826
(5R)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxamide (PubChem CID 67837826) has the molecular formula C6H6N2O2S and a molecular weight of 170.19 g/mol. Its IUPAC name is (5R)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxamide.
| Compound Name | (5R)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxamide |
|---|---|
| PubChem CID | 67837826 |
| Molecular Formula | C6H6N2O2S |
| Molecular Weight | 170.19 g/mol |
| Exact Mass | 170.01 |
| IUPAC Name | (5R)-7-oxo-4-thia-1-azabicyclo[3.2.0]hept-2-ene-2-carboxamide |
| SMILES | NC(=O)C1=CS[C@@H]2CC(=O)N12 |
| InChI | InChI=1S/C6H6N2O2S/c7-6(10)3-2-11-5-1-4(9)8(3)5/h2,5H,1H2,(H2,7,10)/t5-/m1/s1 |
| InChIKey | TYSCTURZVDOPGO-RXMQYKEDSA-N |
| XLogP | -0.38 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.19 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |