About [(2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 3-[(2S)-4-oxoazetidin-2-yl]sulfanylprop-2-enoate
[(2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 3-[(2S)-4-oxoazetidin-2-yl]sulfanylprop-2-enoate (PubChem CID 67837832) has the molecular formula C16H25NO3S
and a molecular weight of 311.45 g/mol. Its IUPAC name is [(2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 3-[(2S)-4-oxoazetidin-2-yl]sulfanylprop-2-enoate.
Molecular Properties
| Compound Name | [(2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 3-[(2S)-4-oxoazetidin-2-yl]sulfanylprop-2-enoate |
| PubChem CID | 67837832 |
| Molecular Formula | C16H25NO3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | [(2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 3-[(2S)-4-oxoazetidin-2-yl]sulfanylprop-2-enoate |
| SMILES | CC(C)[C@@H]1CC[C@H](C)CC1OC(=O)C=CS[C@H]1CC(=O)N1 |
| InChI | InChI=1S/C16H25NO3S/c1-10(2)12-5-4-11(3)8-13(12)20-16(19)6-7-21-15-9-14(18)17-15/h6-7,10-13,15H,4-5,8-9H2,1-3H3,(H,17,18)/t11-,12-,13?,15-/m0/s1 |
| InChIKey | QJZTTWCYEFAAON-VKXBSSMUSA-N |
| XLogP | 3.08 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [(2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 3-[(2S)-4-oxoazetidin-2-yl]sulfanylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 3-[(2S)-4-oxoazetidin-2-yl]sulfanylprop-2-enoate?
The IUPAC name of [(2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 3-[(2S)-4-oxoazetidin-2-yl]sulfanylprop-2-enoate (CID 67837832) is [(2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 3-[(2S)-4-oxoazetidin-2-yl]sulfanylprop-2-enoate.
What is the SMILES notation for [(2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 3-[(2S)-4-oxoazetidin-2-yl]sulfanylprop-2-enoate?
The canonical SMILES for [(2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 3-[(2S)-4-oxoazetidin-2-yl]sulfanylprop-2-enoate is CC(C)[C@@H]1CC[C@H](C)CC1OC(=O)C=CS[C@H]1CC(=O)N1.
What is the InChIKey of [(2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 3-[(2S)-4-oxoazetidin-2-yl]sulfanylprop-2-enoate?
The InChIKey is QJZTTWCYEFAAON-VKXBSSMUSA-N. The full InChI is InChI=1S/C16H25NO3S/c1-10(2)12-5-4-11(3)8-13(12)20-16(19)6-7-21-15-9-14(18)17-15/h6-7,10-13,15H,4-5,8-9H2,1-3H3,(H,17,18)/t11-,12-,13?,15-/m0/s1.
What are the key properties of [(2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 3-[(2S)-4-oxoazetidin-2-yl]sulfanylprop-2-enoate?
[(2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 3-[(2S)-4-oxoazetidin-2-yl]sulfanylprop-2-enoate has a molecular weight of 311.45 g/mol, XLogP of 3.08, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,5S)-5-methyl-2-propan-2-ylcyclohexyl] 3-[(2S)-4-oxoazetidin-2-yl]sulfanylprop-2-enoate is sourced from PubChem (CID 67837832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).