C26H30N4O6 — CID 67837912
(E)-but-2-enedioic acid;3-[2-[4-(5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]ethyl]-1,3-oxazolidin-2-one (PubChem CID 67837912) has the molecular formula C26H30N4O6 and a molecular weight of 494.55 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;3-[2-[4-(5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]ethyl]-1,3-oxazolidin-2-one.
| Compound Name | (E)-but-2-enedioic acid;3-[2-[4-(5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]ethyl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 67837912 |
| Molecular Formula | C26H30N4O6 |
| Molecular Weight | 494.55 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | (E)-but-2-enedioic acid;3-[2-[4-(5,6-dihydroimidazo[2,1-b][3]benzazepin-11-ylidene)piperidin-1-yl]ethyl]-1,3-oxazolidin-2-one |
| SMILES | O=C(O)/C=C/C(=O)O.O=C1OCCN1CCN1CCC(=C2c3ccccc3CCn3ccnc32)CC1 |
| InChI | InChI=1S/C22H26N4O2.C4H4O4/c27-22-26(15-16-28-22)14-13-24-9-5-18(6-10-24)20-19-4-2-1-3-17(19)7-11-25-12-8-23-21(20)25;5-3(6)1-2-4(7)8/h1-4,8,12H,5-7,9-11,13-16H2;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | PQBMUEZHWLAEAR-WLHGVMLRSA-N |
| XLogP | 2.50 |
| TPSA | 125.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.55 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|