About 6-(5-tert-butyl-2-oxo-1,3-oxazol-3-yl)-7-fluoro-4-(methoxymethyl)-1,4-benzoxazin-3-one
6-(5-tert-butyl-2-oxo-1,3-oxazol-3-yl)-7-fluoro-4-(methoxymethyl)-1,4-benzoxazin-3-one (PubChem CID 67838025) has the molecular formula C17H19FN2O5
and a molecular weight of 350.35 g/mol. Its IUPAC name is 6-(5-tert-butyl-2-oxo-1,3-oxazol-3-yl)-7-fluoro-4-(methoxymethyl)-1,4-benzoxazin-3-one.
Molecular Properties
| Compound Name | 6-(5-tert-butyl-2-oxo-1,3-oxazol-3-yl)-7-fluoro-4-(methoxymethyl)-1,4-benzoxazin-3-one |
| PubChem CID | 67838025 |
| Molecular Formula | C17H19FN2O5 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 6-(5-tert-butyl-2-oxo-1,3-oxazol-3-yl)-7-fluoro-4-(methoxymethyl)-1,4-benzoxazin-3-one |
| SMILES | COCN1C(=O)COc2cc(F)c(-n3cc(C(C)(C)C)oc3=O)cc21 |
| InChI | InChI=1S/C17H19FN2O5/c1-17(2,3)14-7-19(16(22)25-14)11-6-12-13(5-10(11)18)24-8-15(21)20(12)9-23-4/h5-7H,8-9H2,1-4H3 |
| InChIKey | JCXOPQQBUFBBTK-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 73.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(5-tert-butyl-2-oxo-1,3-oxazol-3-yl)-7-fluoro-4-(methoxymethyl)-1,4-benzoxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(5-tert-butyl-2-oxo-1,3-oxazol-3-yl)-7-fluoro-4-(methoxymethyl)-1,4-benzoxazin-3-one?
The IUPAC name of 6-(5-tert-butyl-2-oxo-1,3-oxazol-3-yl)-7-fluoro-4-(methoxymethyl)-1,4-benzoxazin-3-one (CID 67838025) is 6-(5-tert-butyl-2-oxo-1,3-oxazol-3-yl)-7-fluoro-4-(methoxymethyl)-1,4-benzoxazin-3-one.
What is the SMILES notation for 6-(5-tert-butyl-2-oxo-1,3-oxazol-3-yl)-7-fluoro-4-(methoxymethyl)-1,4-benzoxazin-3-one?
The canonical SMILES for 6-(5-tert-butyl-2-oxo-1,3-oxazol-3-yl)-7-fluoro-4-(methoxymethyl)-1,4-benzoxazin-3-one is COCN1C(=O)COc2cc(F)c(-n3cc(C(C)(C)C)oc3=O)cc21.
What is the InChIKey of 6-(5-tert-butyl-2-oxo-1,3-oxazol-3-yl)-7-fluoro-4-(methoxymethyl)-1,4-benzoxazin-3-one?
The InChIKey is JCXOPQQBUFBBTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H19FN2O5/c1-17(2,3)14-7-19(16(22)25-14)11-6-12-13(5-10(11)18)24-8-15(21)20(12)9-23-4/h5-7H,8-9H2,1-4H3.
What are the key properties of 6-(5-tert-butyl-2-oxo-1,3-oxazol-3-yl)-7-fluoro-4-(methoxymethyl)-1,4-benzoxazin-3-one?
6-(5-tert-butyl-2-oxo-1,3-oxazol-3-yl)-7-fluoro-4-(methoxymethyl)-1,4-benzoxazin-3-one has a molecular weight of 350.35 g/mol, XLogP of 2.20, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(5-tert-butyl-2-oxo-1,3-oxazol-3-yl)-7-fluoro-4-(methoxymethyl)-1,4-benzoxazin-3-one is sourced from PubChem (CID 67838025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).