C8H14N4O2 — CID 67838221
piperazine;1H-pyrimidine-2,4-dione (PubChem CID 67838221) has the molecular formula C8H14N4O2 and a molecular weight of 198.23 g/mol. Its IUPAC name is piperazine;1H-pyrimidine-2,4-dione.
| Compound Name | piperazine;1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 67838221 |
| Molecular Formula | C8H14N4O2 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.11 |
| IUPAC Name | piperazine;1H-pyrimidine-2,4-dione |
| SMILES | C1CNCCN1.O=c1cc[nH]c(=O)[nH]1 |
| InChI | InChI=1S/C4H4N2O2.C4H10N2/c7-3-1-2-5-4(8)6-3;1-2-6-4-3-5-1/h1-2H,(H2,5,6,7,8);5-6H,1-4H2 |
| InChIKey | ZBTHQPOAMCTRFS-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 89.78 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |