C19H22N2 — CID 67838306
1,5-diazapentacyclo[10.8.1.02,7.08,21.015,20]henicosa-2,6,12(21),14,16-pentaene (PubChem CID 67838306) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is 1,5-diazapentacyclo[10.8.1.02,7.08,21.015,20]henicosa-2,6,12(21),14,16-pentaene.
| Compound Name | 1,5-diazapentacyclo[10.8.1.02,7.08,21.015,20]henicosa-2,6,12(21),14,16-pentaene |
|---|---|
| PubChem CID | 67838306 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | 1,5-diazapentacyclo[10.8.1.02,7.08,21.015,20]henicosa-2,6,12(21),14,16-pentaene |
| SMILES | C1=CC2=CCC3=C4C(CCC3)C3=CNCC=C3N4C2CC1 |
| InChI | InChI=1S/C19H22N2/c1-2-7-17-13(4-1)8-9-14-5-3-6-15-16-12-20-11-10-18(16)21(17)19(14)15/h1,4,8,10,12,15,17,20H,2-3,5-7,9,11H2 |
| InChIKey | SDMQDHZFEHXBHU-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |