C31H38FNO7 — CID 67838378
bis(1-propan-2-yloxyethyl) 4-[2-(2-fluorophenoxy)phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate (PubChem CID 67838378) has the molecular formula C31H38FNO7 and a molecular weight of 555.64 g/mol. Its IUPAC name is bis(1-propan-2-yloxyethyl) 4-[2-(2-fluorophenoxy)phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate.
| Compound Name | bis(1-propan-2-yloxyethyl) 4-[2-(2-fluorophenoxy)phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 67838378 |
| Molecular Formula | C31H38FNO7 |
| Molecular Weight | 555.64 g/mol |
| Exact Mass | 555.26 |
| IUPAC Name | bis(1-propan-2-yloxyethyl) 4-[2-(2-fluorophenoxy)phenyl]-2,6-dimethyl-1,4-dihydropyridine-3,5-dicarboxylate |
| SMILES | CC1=C(C(=O)OC(C)OC(C)C)C(c2ccccc2Oc2ccccc2F)C(C(=O)OC(C)OC(C)C)=C(C)N1 |
| InChI | InChI=1S/C31H38FNO7/c1-17(2)36-21(7)38-30(34)27-19(5)33-20(6)28(31(35)39-22(8)37-18(3)4)29(27)23-13-9-11-15-25(23)40-26-16-12-10-14-24(26)32/h9-18,21-22,29,33H,1-8H3 |
| InChIKey | VFCFXWUBOZCCSB-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 92.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.64 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|