C31H30N4O4S — CID 67838646
2-phenyl-3-[3-[4-[(4R)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carbonyl]piperazin-1-yl]propoxy]chromen-4-one (PubChem CID 67838646) has the molecular formula C31H30N4O4S and a molecular weight of 554.67 g/mol. Its IUPAC name is 2-phenyl-3-[3-[4-[(4R)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carbonyl]piperazin-1-yl]propoxy]chromen-4-one.
| Compound Name | 2-phenyl-3-[3-[4-[(4R)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carbonyl]piperazin-1-yl]propoxy]chromen-4-one |
|---|---|
| PubChem CID | 67838646 |
| Molecular Formula | C31H30N4O4S |
| Molecular Weight | 554.67 g/mol |
| Exact Mass | 554.20 |
| IUPAC Name | 2-phenyl-3-[3-[4-[(4R)-2-pyridin-3-yl-4,5-dihydro-1,3-thiazole-4-carbonyl]piperazin-1-yl]propoxy]chromen-4-one |
| SMILES | O=C([C@@H]1CSC(c2cccnc2)=N1)N1CCN(CCCOc2c(-c3ccccc3)oc3ccccc3c2=O)CC1 |
| InChI | InChI=1S/C31H30N4O4S/c36-27-24-11-4-5-12-26(24)39-28(22-8-2-1-3-9-22)29(27)38-19-7-14-34-15-17-35(18-16-34)31(37)25-21-40-30(33-25)23-10-6-13-32-20-23/h1-6,8-13,20,25H,7,14-19,21H2/t25-/m0/s1 |
| InChIKey | SKFRUGBHPWCFLZ-VWLOTQADSA-N |
| XLogP | 4.33 |
| TPSA | 88.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.67 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|