C47H35N5 — CID 67838980
3-[10,15,20-tris(4-methylphenyl)porphyrin-5-yl]aniline (PubChem CID 67838980) has the molecular formula C47H35N5 and a molecular weight of 669.83 g/mol. Its IUPAC name is 3-[10,15,20-tris(4-methylphenyl)porphyrin-5-yl]aniline.
| Compound Name | 3-[10,15,20-tris(4-methylphenyl)porphyrin-5-yl]aniline |
|---|---|
| PubChem CID | 67838980 |
| Molecular Formula | C47H35N5 |
| Molecular Weight | 669.83 g/mol |
| Exact Mass | 669.29 |
| IUPAC Name | 3-[10,15,20-tris(4-methylphenyl)porphyrin-5-yl]aniline |
| SMILES | Cc1ccc(/C2=C3\C=CC(=N3)/C(c3ccc(C)cc3)=C3/C=CC(=N3)/C(c3cccc(N)c3)=C3/C=CC(=N3)/C(c3ccc(C)cc3)=C3/C=CC2=N3)cc1 |
| InChI | InChI=1S/C47H35N5/c1-28-7-13-31(14-8-28)44-36-19-21-38(49-36)45(32-15-9-29(2)10-16-32)40-23-25-42(51-40)47(34-5-4-6-35(48)27-34)43-26-24-41(52-43)46(39-22-20-37(44)50-39)33-17-11-30(3)12-18-33/h4-27H,48H2,1-3H3/b44-36-,44-37-,45-38-,45-40-,46-39-,46-41-,47-42-,47-43- |
| InChIKey | HXXZOGHUVCYZOE-ZQANTMHOSA-N |
| XLogP | 10.20 |
| TPSA | 75.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.83 |
| LogP ≤ 5 | 10.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|