About N-[[3-cyclohexyl-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpropylidene]amino]methanamine
N-[[3-cyclohexyl-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpropylidene]amino]methanamine (PubChem CID 67839037) has the molecular formula C16H26N4O2S
and a molecular weight of 338.48 g/mol. Its IUPAC name is N-[[3-cyclohexyl-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpropylidene]amino]methanamine.
Molecular Properties
| Compound Name | N-[[3-cyclohexyl-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpropylidene]amino]methanamine |
| PubChem CID | 67839037 |
| Molecular Formula | C16H26N4O2S |
| Molecular Weight | 338.48 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | N-[[3-cyclohexyl-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpropylidene]amino]methanamine |
| SMILES | CNN=CC(CC1CCCCC1)Sc1nc(OC)cc(OC)n1 |
| InChI | InChI=1S/C16H26N4O2S/c1-17-18-11-13(9-12-7-5-4-6-8-12)23-16-19-14(21-2)10-15(20-16)22-3/h10-13,17H,4-9H2,1-3H3 |
| InChIKey | MFQBRTHLAMRABK-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 68.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.48 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-[[3-cyclohexyl-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpropylidene]amino]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-cyclohexyl-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpropylidene]amino]methanamine?
The IUPAC name of N-[[3-cyclohexyl-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpropylidene]amino]methanamine (CID 67839037) is N-[[3-cyclohexyl-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpropylidene]amino]methanamine.
What is the SMILES notation for N-[[3-cyclohexyl-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpropylidene]amino]methanamine?
The canonical SMILES for N-[[3-cyclohexyl-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpropylidene]amino]methanamine is CNN=CC(CC1CCCCC1)Sc1nc(OC)cc(OC)n1.
What is the InChIKey of N-[[3-cyclohexyl-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpropylidene]amino]methanamine?
The InChIKey is MFQBRTHLAMRABK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H26N4O2S/c1-17-18-11-13(9-12-7-5-4-6-8-12)23-16-19-14(21-2)10-15(20-16)22-3/h10-13,17H,4-9H2,1-3H3.
What are the key properties of N-[[3-cyclohexyl-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpropylidene]amino]methanamine?
N-[[3-cyclohexyl-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpropylidene]amino]methanamine has a molecular weight of 338.48 g/mol, XLogP of 3.13, 8 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-cyclohexyl-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylpropylidene]amino]methanamine is sourced from PubChem (CID 67839037), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).