C26H23N3O3 — CID 67839378
3-[3-(hydroxymethyl)-1,2,3,4-tetrahydropyrido[1,2-a]indol-10-yl]-4-(1-methylindol-3-yl)pyrrole-2,5-dione (PubChem CID 67839378) has the molecular formula C26H23N3O3 and a molecular weight of 425.49 g/mol. Its IUPAC name is 3-[3-(hydroxymethyl)-1,2,3,4-tetrahydropyrido[1,2-a]indol-10-yl]-4-(1-methylindol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-[3-(hydroxymethyl)-1,2,3,4-tetrahydropyrido[1,2-a]indol-10-yl]-4-(1-methylindol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 67839378 |
| Molecular Formula | C26H23N3O3 |
| Molecular Weight | 425.49 g/mol |
| Exact Mass | 425.17 |
| IUPAC Name | 3-[3-(hydroxymethyl)-1,2,3,4-tetrahydropyrido[1,2-a]indol-10-yl]-4-(1-methylindol-3-yl)pyrrole-2,5-dione |
| SMILES | Cn1cc(C2=C(c3c4c(n5ccccc35)CC(CO)CC4)C(=O)NC2=O)c2ccccc21 |
| InChI | InChI=1S/C26H23N3O3/c1-28-13-18(16-6-2-3-7-19(16)28)23-24(26(32)27-25(23)31)22-17-10-9-15(14-30)12-21(17)29-11-5-4-8-20(22)29/h2-8,11,13,15,30H,9-10,12,14H2,1H3,(H,27,31,32) |
| InChIKey | GTODXTYQWKHBSU-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 75.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.49 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|