C14H20O10 — CID 67839678
1-[(2R,3R,4S,5S)-4,5,6-triacetyl-3,4,5,6-tetrahydroxy-2-(hydroxymethyl)oxan-3-yl]ethanone (PubChem CID 67839678) has the molecular formula C14H20O10 and a molecular weight of 348.30 g/mol. Its IUPAC name is 1-[(2R,3R,4S,5S)-4,5,6-triacetyl-3,4,5,6-tetrahydroxy-2-(hydroxymethyl)oxan-3-yl]ethanone.
| Compound Name | 1-[(2R,3R,4S,5S)-4,5,6-triacetyl-3,4,5,6-tetrahydroxy-2-(hydroxymethyl)oxan-3-yl]ethanone |
|---|---|
| PubChem CID | 67839678 |
| Molecular Formula | C14H20O10 |
| Molecular Weight | 348.30 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | 1-[(2R,3R,4S,5S)-4,5,6-triacetyl-3,4,5,6-tetrahydroxy-2-(hydroxymethyl)oxan-3-yl]ethanone |
| SMILES | CC(=O)C1(O)O[C@H](CO)[C@](O)(C(C)=O)[C@@](O)(C(C)=O)[C@]1(O)C(C)=O |
| InChI | InChI=1S/C14H20O10/c1-6(16)11(20)10(5-15)24-14(23,9(4)19)13(22,8(3)18)12(11,21)7(2)17/h10,15,20-23H,5H2,1-4H3/t10-,11-,12+,13-,14?/m1/s1 |
| InChIKey | NCVWKOWDCKUIPP-RQICVUQASA-N |
| XLogP | -3.38 |
| TPSA | 178.66 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.30 |
| LogP ≤ 5 | -3.38 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |