About (2-phenyl-3H-1,3-thiazol-2-yl) acetate
(2-phenyl-3H-1,3-thiazol-2-yl) acetate (PubChem CID 67839772) has the molecular formula C11H11NO2S
and a molecular weight of 221.28 g/mol. Its IUPAC name is (2-phenyl-3H-1,3-thiazol-2-yl) acetate.
Molecular Properties
| Compound Name | (2-phenyl-3H-1,3-thiazol-2-yl) acetate |
| PubChem CID | 67839772 |
| Molecular Formula | C11H11NO2S |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.05 |
| IUPAC Name | (2-phenyl-3H-1,3-thiazol-2-yl) acetate |
| SMILES | CC(=O)OC1(c2ccccc2)NC=CS1 |
| InChI | InChI=1S/C11H11NO2S/c1-9(13)14-11(12-7-8-15-11)10-5-3-2-4-6-10/h2-8,12H,1H3 |
| InChIKey | WKABSACMENHTEP-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2-phenyl-3H-1,3-thiazol-2-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-phenyl-3H-1,3-thiazol-2-yl) acetate?
The IUPAC name of (2-phenyl-3H-1,3-thiazol-2-yl) acetate (CID 67839772) is (2-phenyl-3H-1,3-thiazol-2-yl) acetate.
What is the SMILES notation for (2-phenyl-3H-1,3-thiazol-2-yl) acetate?
The canonical SMILES for (2-phenyl-3H-1,3-thiazol-2-yl) acetate is CC(=O)OC1(c2ccccc2)NC=CS1.
What is the InChIKey of (2-phenyl-3H-1,3-thiazol-2-yl) acetate?
The InChIKey is WKABSACMENHTEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO2S/c1-9(13)14-11(12-7-8-15-11)10-5-3-2-4-6-10/h2-8,12H,1H3.
What are the key properties of (2-phenyl-3H-1,3-thiazol-2-yl) acetate?
(2-phenyl-3H-1,3-thiazol-2-yl) acetate has a molecular weight of 221.28 g/mol, XLogP of 2.17, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-phenyl-3H-1,3-thiazol-2-yl) acetate is sourced from PubChem (CID 67839772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).