C26H28FN3O3 — CID 67840685
4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]pent-4-enyl 2,3-dihydroindole-1-carboxylate (PubChem CID 67840685) has the molecular formula C26H28FN3O3 and a molecular weight of 449.53 g/mol. Its IUPAC name is 4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]pent-4-enyl 2,3-dihydroindole-1-carboxylate.
| Compound Name | 4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]pent-4-enyl 2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 67840685 |
| Molecular Formula | C26H28FN3O3 |
| Molecular Weight | 449.53 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | 4-[4-(6-fluoro-1,2-benzoxazol-3-yl)piperidin-1-yl]pent-4-enyl 2,3-dihydroindole-1-carboxylate |
| SMILES | C=C(CCCOC(=O)N1CCc2ccccc21)N1CCC(c2noc3cc(F)ccc23)CC1 |
| InChI | InChI=1S/C26H28FN3O3/c1-18(5-4-16-32-26(31)30-15-12-19-6-2-3-7-23(19)30)29-13-10-20(11-14-29)25-22-9-8-21(27)17-24(22)33-28-25/h2-3,6-9,17,20H,1,4-5,10-16H2 |
| InChIKey | CHQWRXSYUWIACP-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 58.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|