About ethane-1,2-diol;1-hydroxyadamantan-2-one
ethane-1,2-diol;1-hydroxyadamantan-2-one (PubChem CID 67841434) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is ethane-1,2-diol;1-hydroxyadamantan-2-one.
Molecular Properties
| Compound Name | ethane-1,2-diol;1-hydroxyadamantan-2-one |
| PubChem CID | 67841434 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | ethane-1,2-diol;1-hydroxyadamantan-2-one |
| SMILES | O=C1C2CC3CC(C2)CC1(O)C3.OCCO |
| InChI | InChI=1S/C10H14O2.C2H6O2/c11-9-8-2-6-1-7(3-8)5-10(9,12)4-6;3-1-2-4/h6-8,12H,1-5H2;3-4H,1-2H2 |
| InChIKey | QZKLJDUBBJQJRU-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethane-1,2-diol;1-hydroxyadamantan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane-1,2-diol;1-hydroxyadamantan-2-one?
The IUPAC name of ethane-1,2-diol;1-hydroxyadamantan-2-one (CID 67841434) is ethane-1,2-diol;1-hydroxyadamantan-2-one.
What is the SMILES notation for ethane-1,2-diol;1-hydroxyadamantan-2-one?
The canonical SMILES for ethane-1,2-diol;1-hydroxyadamantan-2-one is O=C1C2CC3CC(C2)CC1(O)C3.OCCO.
What is the InChIKey of ethane-1,2-diol;1-hydroxyadamantan-2-one?
The InChIKey is QZKLJDUBBJQJRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14O2.C2H6O2/c11-9-8-2-6-1-7(3-8)5-10(9,12)4-6;3-1-2-4/h6-8,12H,1-5H2;3-4H,1-2H2.
What are the key properties of ethane-1,2-diol;1-hydroxyadamantan-2-one?
ethane-1,2-diol;1-hydroxyadamantan-2-one has a molecular weight of 228.29 g/mol, XLogP of 0.10, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane-1,2-diol;1-hydroxyadamantan-2-one is sourced from PubChem (CID 67841434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).