C16H36O8Si3 — CID 67842010
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[3-[methyl-bis(trimethylsilyloxy)silyl]prop-2-enoxy]oxane-3,4,5-triol (PubChem CID 67842010) has the molecular formula C16H36O8Si3 and a molecular weight of 440.71 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[3-[methyl-bis(trimethylsilyloxy)silyl]prop-2-enoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[3-[methyl-bis(trimethylsilyloxy)silyl]prop-2-enoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 67842010 |
| Molecular Formula | C16H36O8Si3 |
| Molecular Weight | 440.71 g/mol |
| Exact Mass | 440.17 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[3-[methyl-bis(trimethylsilyloxy)silyl]prop-2-enoxy]oxane-3,4,5-triol |
| SMILES | C[Si](C)(C)O[Si](C)(C=CCO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)O[Si](C)(C)C |
| InChI | InChI=1S/C16H36O8Si3/c1-25(2,3)23-27(7,24-26(4,5)6)10-8-9-21-16-15(20)14(19)13(18)12(11-17)22-16/h8,10,12-20H,9,11H2,1-7H3/t12-,13-,14+,15-,16-/m1/s1 |
| InChIKey | DIEHINONVBBFKL-IBEHDNSVSA-N |
| XLogP | 0.67 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.71 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|