C22H46O13Si3 — CID 67842012
(2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[(2R,3S,4S,5R)-3,4,5-trihydroxy-5-[3-[methyl-bis(trimethylsilyloxy)silyl]prop-2-enoxymethyl]oxolan-2-yl]methoxy]oxane-3,4,5-triol (PubChem CID 67842012) has the molecular formula C22H46O13Si3 and a molecular weight of 602.86 g/mol. Its IUPAC name is (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[(2R,3S,4S,5R)-3,4,5-trihydroxy-5-[3-[methyl-bis(trimethylsilyloxy)silyl]prop-2-enoxymethyl]oxolan-2-yl]methoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[(2R,3S,4S,5R)-3,4,5-trihydroxy-5-[3-[methyl-bis(trimethylsilyloxy)silyl]prop-2-enoxymethyl]oxolan-2-yl]methoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 67842012 |
| Molecular Formula | C22H46O13Si3 |
| Molecular Weight | 602.86 g/mol |
| Exact Mass | 602.22 |
| IUPAC Name | (2R,3S,4S,5R,6S)-2-(hydroxymethyl)-6-[[(2R,3S,4S,5R)-3,4,5-trihydroxy-5-[3-[methyl-bis(trimethylsilyloxy)silyl]prop-2-enoxymethyl]oxolan-2-yl]methoxy]oxane-3,4,5-triol |
| SMILES | C[Si](C)(C)O[Si](C)(C=CCOC[C@@]1(O)O[C@H](CO[C@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)[C@@H](O)[C@@H]1O)O[Si](C)(C)C |
| InChI | InChI=1S/C22H46O13Si3/c1-36(2,3)34-38(7,35-37(4,5)6)10-8-9-30-13-22(29)20(28)17(25)15(33-22)12-31-21-19(27)18(26)16(24)14(11-23)32-21/h8,10,14-21,23-29H,9,11-13H2,1-7H3/t14-,15-,16-,17-,18+,19-,20+,21+,22-/m1/s1 |
| InChIKey | XDYQFYOLNQSLFD-QFSLIYOSSA-N |
| XLogP | -1.50 |
| TPSA | 196.99 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.86 |
| LogP ≤ 5 | -1.50 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|