C17H38O8Si3 — CID 67842017
(2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-[methyl-bis(trimethylsilyloxy)silyl]but-3-enoxy]oxane-3,4,5-triol (PubChem CID 67842017) has the molecular formula C17H38O8Si3 and a molecular weight of 454.74 g/mol. Its IUPAC name is (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-[methyl-bis(trimethylsilyloxy)silyl]but-3-enoxy]oxane-3,4,5-triol.
| Compound Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-[methyl-bis(trimethylsilyloxy)silyl]but-3-enoxy]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 67842017 |
| Molecular Formula | C17H38O8Si3 |
| Molecular Weight | 454.74 g/mol |
| Exact Mass | 454.19 |
| IUPAC Name | (2R,3S,4S,5R,6R)-2-(hydroxymethyl)-6-[4-[methyl-bis(trimethylsilyloxy)silyl]but-3-enoxy]oxane-3,4,5-triol |
| SMILES | C[Si](C)(C)O[Si](C)(C=CCCO[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)O[Si](C)(C)C |
| InChI | InChI=1S/C17H38O8Si3/c1-26(2,3)24-28(7,25-27(4,5)6)11-9-8-10-22-17-16(21)15(20)14(19)13(12-18)23-17/h9,11,13-21H,8,10,12H2,1-7H3/t13-,14-,15+,16-,17-/m1/s1 |
| InChIKey | LGKQBEHQYNDNSM-NQNKBUKLSA-N |
| XLogP | 1.06 |
| TPSA | 117.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.74 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|