About 7-chloro-4-[(4,6-dimethoxy-1,3,5-triazin-2-yl)sulfanyl]quinoline
7-chloro-4-[(4,6-dimethoxy-1,3,5-triazin-2-yl)sulfanyl]quinoline (PubChem CID 67842022) has the molecular formula C14H11ClN4O2S
and a molecular weight of 334.79 g/mol. Its IUPAC name is 7-chloro-4-[(4,6-dimethoxy-1,3,5-triazin-2-yl)sulfanyl]quinoline.
Molecular Properties
| Compound Name | 7-chloro-4-[(4,6-dimethoxy-1,3,5-triazin-2-yl)sulfanyl]quinoline |
| PubChem CID | 67842022 |
| Molecular Formula | C14H11ClN4O2S |
| Molecular Weight | 334.79 g/mol |
| Exact Mass | 334.03 |
| IUPAC Name | 7-chloro-4-[(4,6-dimethoxy-1,3,5-triazin-2-yl)sulfanyl]quinoline |
| SMILES | COc1nc(OC)nc(Sc2ccnc3cc(Cl)ccc23)n1 |
| InChI | InChI=1S/C14H11ClN4O2S/c1-20-12-17-13(21-2)19-14(18-12)22-11-5-6-16-10-7-8(15)3-4-9(10)11/h3-7H,1-2H3 |
| InChIKey | CKJSESKSSSXAKN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 70.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.79 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 7-chloro-4-[(4,6-dimethoxy-1,3,5-triazin-2-yl)sulfanyl]quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-chloro-4-[(4,6-dimethoxy-1,3,5-triazin-2-yl)sulfanyl]quinoline?
The IUPAC name of 7-chloro-4-[(4,6-dimethoxy-1,3,5-triazin-2-yl)sulfanyl]quinoline (CID 67842022) is 7-chloro-4-[(4,6-dimethoxy-1,3,5-triazin-2-yl)sulfanyl]quinoline.
What is the SMILES notation for 7-chloro-4-[(4,6-dimethoxy-1,3,5-triazin-2-yl)sulfanyl]quinoline?
The canonical SMILES for 7-chloro-4-[(4,6-dimethoxy-1,3,5-triazin-2-yl)sulfanyl]quinoline is COc1nc(OC)nc(Sc2ccnc3cc(Cl)ccc23)n1.
What is the InChIKey of 7-chloro-4-[(4,6-dimethoxy-1,3,5-triazin-2-yl)sulfanyl]quinoline?
The InChIKey is CKJSESKSSSXAKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H11ClN4O2S/c1-20-12-17-13(21-2)19-14(18-12)22-11-5-6-16-10-7-8(15)3-4-9(10)11/h3-7H,1-2H3.
What are the key properties of 7-chloro-4-[(4,6-dimethoxy-1,3,5-triazin-2-yl)sulfanyl]quinoline?
7-chloro-4-[(4,6-dimethoxy-1,3,5-triazin-2-yl)sulfanyl]quinoline has a molecular weight of 334.79 g/mol, XLogP of 3.24, 4 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-chloro-4-[(4,6-dimethoxy-1,3,5-triazin-2-yl)sulfanyl]quinoline is sourced from PubChem (CID 67842022), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).