About fluorobenzene;2-trimethylsilylethanamine
fluorobenzene;2-trimethylsilylethanamine (PubChem CID 67842077) has the molecular formula C11H20FNSi
and a molecular weight of 213.37 g/mol. Its IUPAC name is fluorobenzene;2-trimethylsilylethanamine.
Molecular Properties
| Compound Name | fluorobenzene;2-trimethylsilylethanamine |
| PubChem CID | 67842077 |
| Molecular Formula | C11H20FNSi |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.13 |
| IUPAC Name | fluorobenzene;2-trimethylsilylethanamine |
| SMILES | C[Si](C)(C)CCN.Fc1ccccc1 |
| InChI | InChI=1S/C6H5F.C5H15NSi/c7-6-4-2-1-3-5-6;1-7(2,3)5-4-6/h1-5H;4-6H2,1-3H3 |
| InChIKey | YSSNXZHBYZBOHM-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze fluorobenzene;2-trimethylsilylethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of fluorobenzene;2-trimethylsilylethanamine?
The IUPAC name of fluorobenzene;2-trimethylsilylethanamine (CID 67842077) is fluorobenzene;2-trimethylsilylethanamine.
What is the SMILES notation for fluorobenzene;2-trimethylsilylethanamine?
The canonical SMILES for fluorobenzene;2-trimethylsilylethanamine is C[Si](C)(C)CCN.Fc1ccccc1.
What is the InChIKey of fluorobenzene;2-trimethylsilylethanamine?
The InChIKey is YSSNXZHBYZBOHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5F.C5H15NSi/c7-6-4-2-1-3-5-6;1-7(2,3)5-4-6/h1-5H;4-6H2,1-3H3.
What are the key properties of fluorobenzene;2-trimethylsilylethanamine?
fluorobenzene;2-trimethylsilylethanamine has a molecular weight of 213.37 g/mol, XLogP of 3.11, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for fluorobenzene;2-trimethylsilylethanamine is sourced from PubChem (CID 67842077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).