C16H23Cl3NO2Si — CID 67842343
CID 67842343 (PubChem CID 67842343) has the molecular formula C16H23Cl3NO2Si and a molecular weight of 395.81 g/mol.
| Compound Name | CID 67842343 |
|---|---|
| PubChem CID | 67842343 |
| Molecular Formula | C16H23Cl3NO2Si |
| Molecular Weight | 395.81 g/mol |
| Exact Mass | 394.06 |
| IUPAC Name | — |
| SMILES | C[Si](C)OC(c1cccc(CNC(=O)C(Cl)(Cl)Cl)c1)C(C)(C)C |
| InChI | InChI=1S/C16H23Cl3NO2Si/c1-15(2,3)13(22-23(4)5)12-8-6-7-11(9-12)10-20-14(21)16(17,18)19/h6-9,13H,10H2,1-5H3,(H,20,21) |
| InChIKey | NPDXJBHFKWMMBA-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.81 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|