C20H25F — CID 67842368
2-fluoro-1-pentyl-4-(4-propylphenyl)benzene (PubChem CID 67842368) has the molecular formula C20H25F and a molecular weight of 284.42 g/mol. Its IUPAC name is 2-fluoro-1-pentyl-4-(4-propylphenyl)benzene.
| Compound Name | 2-fluoro-1-pentyl-4-(4-propylphenyl)benzene |
|---|---|
| PubChem CID | 67842368 |
| Molecular Formula | C20H25F |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 2-fluoro-1-pentyl-4-(4-propylphenyl)benzene |
| SMILES | CCCCCc1ccc(-c2ccc(CCC)cc2)cc1F |
| InChI | InChI=1S/C20H25F/c1-3-5-6-8-18-13-14-19(15-20(18)21)17-11-9-16(7-4-2)10-12-17/h9-15H,3-8H2,1-2H3 |
| InChIKey | ZPEGDPOGSJGCDI-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|