C21H27FO — CID 67842431
1-(4-butoxyphenyl)-2-fluoro-4-pentylbenzene (PubChem CID 67842431) has the molecular formula C21H27FO and a molecular weight of 314.44 g/mol. Its IUPAC name is 1-(4-butoxyphenyl)-2-fluoro-4-pentylbenzene.
| Compound Name | 1-(4-butoxyphenyl)-2-fluoro-4-pentylbenzene |
|---|---|
| PubChem CID | 67842431 |
| Molecular Formula | C21H27FO |
| Molecular Weight | 314.44 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | 1-(4-butoxyphenyl)-2-fluoro-4-pentylbenzene |
| SMILES | CCCCCc1ccc(-c2ccc(OCCCC)cc2)c(F)c1 |
| InChI | InChI=1S/C21H27FO/c1-3-5-7-8-17-9-14-20(21(22)16-17)18-10-12-19(13-11-18)23-15-6-4-2/h9-14,16H,3-8,15H2,1-2H3 |
| InChIKey | ZSXOBTNZPOGGNF-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.44 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|