About 3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylbutan-1-ol
3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylbutan-1-ol (PubChem CID 67842640) has the molecular formula C16H19ClN2O3S
and a molecular weight of 354.86 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylbutan-1-ol.
Molecular Properties
| Compound Name | 3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylbutan-1-ol |
| PubChem CID | 67842640 |
| Molecular Formula | C16H19ClN2O3S |
| Molecular Weight | 354.86 g/mol |
| Exact Mass | 354.08 |
| IUPAC Name | 3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylbutan-1-ol |
| SMILES | COc1cc(OC)nc(SC(CO)C(C)c2ccc(Cl)cc2)n1 |
| InChI | InChI=1S/C16H19ClN2O3S/c1-10(11-4-6-12(17)7-5-11)13(9-20)23-16-18-14(21-2)8-15(19-16)22-3/h4-8,10,13,20H,9H2,1-3H3 |
| InChIKey | MOKSYIUQJHGTMQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.86 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylbutan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylbutan-1-ol?
The IUPAC name of 3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylbutan-1-ol (CID 67842640) is 3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylbutan-1-ol.
What is the SMILES notation for 3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylbutan-1-ol?
The canonical SMILES for 3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylbutan-1-ol is COc1cc(OC)nc(SC(CO)C(C)c2ccc(Cl)cc2)n1.
What is the InChIKey of 3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylbutan-1-ol?
The InChIKey is MOKSYIUQJHGTMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19ClN2O3S/c1-10(11-4-6-12(17)7-5-11)13(9-20)23-16-18-14(21-2)8-15(19-16)22-3/h4-8,10,13,20H,9H2,1-3H3.
What are the key properties of 3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylbutan-1-ol?
3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylbutan-1-ol has a molecular weight of 354.86 g/mol, XLogP of 3.40, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-chlorophenyl)-2-(4,6-dimethoxypyrimidin-2-yl)sulfanylbutan-1-ol is sourced from PubChem (CID 67842640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).