C28H46N4O4 — CID 67842881
1-[9,18-diamino-8-(3-methyl-2,5-dioxopyrrol-1-yl)octadecyl]-3-methylpyrrole-2,5-dione (PubChem CID 67842881) has the molecular formula C28H46N4O4 and a molecular weight of 502.70 g/mol. Its IUPAC name is 1-[9,18-diamino-8-(3-methyl-2,5-dioxopyrrol-1-yl)octadecyl]-3-methylpyrrole-2,5-dione.
| Compound Name | 1-[9,18-diamino-8-(3-methyl-2,5-dioxopyrrol-1-yl)octadecyl]-3-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 67842881 |
| Molecular Formula | C28H46N4O4 |
| Molecular Weight | 502.70 g/mol |
| Exact Mass | 502.35 |
| IUPAC Name | 1-[9,18-diamino-8-(3-methyl-2,5-dioxopyrrol-1-yl)octadecyl]-3-methylpyrrole-2,5-dione |
| SMILES | CC1=CC(=O)N(CCCCCCCC(C(N)CCCCCCCCCN)N2C(=O)C=C(C)C2=O)C1=O |
| InChI | InChI=1S/C28H46N4O4/c1-21-19-25(33)31(27(21)35)18-14-10-6-8-12-16-24(32-26(34)20-22(2)28(32)36)23(30)15-11-7-4-3-5-9-13-17-29/h19-20,23-24H,3-18,29-30H2,1-2H3 |
| InChIKey | BJAFOHVDDKUPTF-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.70 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|