C24H38N4O4 — CID 67842882
1-[7,14-diamino-6-(3-methyl-2,5-dioxopyrrol-1-yl)tetradecyl]-3-methylpyrrole-2,5-dione (PubChem CID 67842882) has the molecular formula C24H38N4O4 and a molecular weight of 446.59 g/mol. Its IUPAC name is 1-[7,14-diamino-6-(3-methyl-2,5-dioxopyrrol-1-yl)tetradecyl]-3-methylpyrrole-2,5-dione.
| Compound Name | 1-[7,14-diamino-6-(3-methyl-2,5-dioxopyrrol-1-yl)tetradecyl]-3-methylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 67842882 |
| Molecular Formula | C24H38N4O4 |
| Molecular Weight | 446.59 g/mol |
| Exact Mass | 446.29 |
| IUPAC Name | 1-[7,14-diamino-6-(3-methyl-2,5-dioxopyrrol-1-yl)tetradecyl]-3-methylpyrrole-2,5-dione |
| SMILES | CC1=CC(=O)N(CCCCCC(C(N)CCCCCCCN)N2C(=O)C=C(C)C2=O)C1=O |
| InChI | InChI=1S/C24H38N4O4/c1-17-15-21(29)27(23(17)31)14-10-6-8-12-20(28-22(30)16-18(2)24(28)32)19(26)11-7-4-3-5-9-13-25/h15-16,19-20H,3-14,25-26H2,1-2H3 |
| InChIKey | USRLAIZZGAOPGG-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 126.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.59 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|