About 3-chloro-4-(trifluoromethyl)aniline;2-methyl-2-thiophen-2-ylpropanoic acid
3-chloro-4-(trifluoromethyl)aniline;2-methyl-2-thiophen-2-ylpropanoic acid (PubChem CID 67842918) has the molecular formula C15H15ClF3NO2S
and a molecular weight of 365.80 g/mol. Its IUPAC name is 3-chloro-4-(trifluoromethyl)aniline;2-methyl-2-thiophen-2-ylpropanoic acid.
Molecular Properties
| Compound Name | 3-chloro-4-(trifluoromethyl)aniline;2-methyl-2-thiophen-2-ylpropanoic acid |
| PubChem CID | 67842918 |
| Molecular Formula | C15H15ClF3NO2S |
| Molecular Weight | 365.80 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 3-chloro-4-(trifluoromethyl)aniline;2-methyl-2-thiophen-2-ylpropanoic acid |
| SMILES | CC(C)(C(=O)O)c1cccs1.Nc1ccc(C(F)(F)F)c(Cl)c1 |
| InChI | InChI=1S/C8H10O2S.C7H5ClF3N/c1-8(2,7(9)10)6-4-3-5-11-6;8-6-3-4(12)1-2-5(6)7(9,10)11/h3-5H,1-2H3,(H,9,10);1-3H,12H2 |
| InChIKey | KXMMGTQWGUVQGR-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.80 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-chloro-4-(trifluoromethyl)aniline;2-methyl-2-thiophen-2-ylpropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-chloro-4-(trifluoromethyl)aniline;2-methyl-2-thiophen-2-ylpropanoic acid?
The IUPAC name of 3-chloro-4-(trifluoromethyl)aniline;2-methyl-2-thiophen-2-ylpropanoic acid (CID 67842918) is 3-chloro-4-(trifluoromethyl)aniline;2-methyl-2-thiophen-2-ylpropanoic acid.
What is the SMILES notation for 3-chloro-4-(trifluoromethyl)aniline;2-methyl-2-thiophen-2-ylpropanoic acid?
The canonical SMILES for 3-chloro-4-(trifluoromethyl)aniline;2-methyl-2-thiophen-2-ylpropanoic acid is CC(C)(C(=O)O)c1cccs1.Nc1ccc(C(F)(F)F)c(Cl)c1.
What is the InChIKey of 3-chloro-4-(trifluoromethyl)aniline;2-methyl-2-thiophen-2-ylpropanoic acid?
The InChIKey is KXMMGTQWGUVQGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2S.C7H5ClF3N/c1-8(2,7(9)10)6-4-3-5-11-6;8-6-3-4(12)1-2-5(6)7(9,10)11/h3-5H,1-2H3,(H,9,10);1-3H,12H2.
What are the key properties of 3-chloro-4-(trifluoromethyl)aniline;2-methyl-2-thiophen-2-ylpropanoic acid?
3-chloro-4-(trifluoromethyl)aniline;2-methyl-2-thiophen-2-ylpropanoic acid has a molecular weight of 365.80 g/mol, XLogP of 5.05, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-chloro-4-(trifluoromethyl)aniline;2-methyl-2-thiophen-2-ylpropanoic acid is sourced from PubChem (CID 67842918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).