About 3-bromo-7-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine
3-bromo-7-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine (PubChem CID 67843076) has the molecular formula C8H7BrClN
and a molecular weight of 232.51 g/mol. Its IUPAC name is 3-bromo-7-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine.
Molecular Properties
| Compound Name | 3-bromo-7-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine |
| PubChem CID | 67843076 |
| Molecular Formula | C8H7BrClN |
| Molecular Weight | 232.51 g/mol |
| Exact Mass | 230.95 |
| IUPAC Name | 3-bromo-7-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine |
| SMILES | ClC1CCc2cc(Br)cnc21 |
| InChI | InChI=1S/C8H7BrClN/c9-6-3-5-1-2-7(10)8(5)11-4-6/h3-4,7H,1-2H2 |
| InChIKey | OOUWZODZBUKODH-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.51 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-7-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-7-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine?
The IUPAC name of 3-bromo-7-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine (CID 67843076) is 3-bromo-7-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine.
What is the SMILES notation for 3-bromo-7-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine?
The canonical SMILES for 3-bromo-7-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine is ClC1CCc2cc(Br)cnc21.
What is the InChIKey of 3-bromo-7-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine?
The InChIKey is OOUWZODZBUKODH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrClN/c9-6-3-5-1-2-7(10)8(5)11-4-6/h3-4,7H,1-2H2.
What are the key properties of 3-bromo-7-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine?
3-bromo-7-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine has a molecular weight of 232.51 g/mol, XLogP of 3.07, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-7-chloro-6,7-dihydro-5H-cyclopenta[b]pyridine is sourced from PubChem (CID 67843076), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).