C19H22N2 — CID 67843275
(7S,8R)-1,5-diazapentacyclo[10.8.1.02,7.08,21.015,20]henicosa-2,4,12(21),14,16-pentaene (PubChem CID 67843275) has the molecular formula C19H22N2 and a molecular weight of 278.40 g/mol. Its IUPAC name is (7S,8R)-1,5-diazapentacyclo[10.8.1.02,7.08,21.015,20]henicosa-2,4,12(21),14,16-pentaene.
| Compound Name | (7S,8R)-1,5-diazapentacyclo[10.8.1.02,7.08,21.015,20]henicosa-2,4,12(21),14,16-pentaene |
|---|---|
| PubChem CID | 67843275 |
| Molecular Formula | C19H22N2 |
| Molecular Weight | 278.40 g/mol |
| Exact Mass | 278.18 |
| IUPAC Name | (7S,8R)-1,5-diazapentacyclo[10.8.1.02,7.08,21.015,20]henicosa-2,4,12(21),14,16-pentaene |
| SMILES | C1=CC2=CCC3=C4[C@H](CCC3)[C@H]3CN=CC=C3N4C2CC1 |
| InChI | InChI=1S/C19H22N2/c1-2-7-17-13(4-1)8-9-14-5-3-6-15-16-12-20-11-10-18(16)21(17)19(14)15/h1,4,8,10-11,15-17H,2-3,5-7,9,12H2/t15-,16-,17?/m1/s1 |
| InChIKey | XNKUPIVXDIMRMV-YNPPLXCJSA-N |
| XLogP | 3.99 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.40 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |