About 3-(2-naphthalen-2-ylethyl)-6-[3-(trifluoromethyl)phenyl]-2,4-dihydro-1H-pyrimidine
3-(2-naphthalen-2-ylethyl)-6-[3-(trifluoromethyl)phenyl]-2,4-dihydro-1H-pyrimidine (PubChem CID 67843489) has the molecular formula C23H21F3N2
and a molecular weight of 382.43 g/mol. Its IUPAC name is 3-(2-naphthalen-2-ylethyl)-6-[3-(trifluoromethyl)phenyl]-2,4-dihydro-1H-pyrimidine.
Molecular Properties
| Compound Name | 3-(2-naphthalen-2-ylethyl)-6-[3-(trifluoromethyl)phenyl]-2,4-dihydro-1H-pyrimidine |
| PubChem CID | 67843489 |
| Molecular Formula | C23H21F3N2 |
| Molecular Weight | 382.43 g/mol |
| Exact Mass | 382.17 |
| IUPAC Name | 3-(2-naphthalen-2-ylethyl)-6-[3-(trifluoromethyl)phenyl]-2,4-dihydro-1H-pyrimidine |
| SMILES | FC(F)(F)c1cccc(C2=CCN(CCc3ccc4ccccc4c3)CN2)c1 |
| InChI | InChI=1S/C23H21F3N2/c24-23(25,26)21-7-3-6-20(15-21)22-11-13-28(16-27-22)12-10-17-8-9-18-4-1-2-5-19(18)14-17/h1-9,11,14-15,27H,10,12-13,16H2 |
| InChIKey | UQLOCJZTBVIVPV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 382.43 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(2-naphthalen-2-ylethyl)-6-[3-(trifluoromethyl)phenyl]-2,4-dihydro-1H-pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-naphthalen-2-ylethyl)-6-[3-(trifluoromethyl)phenyl]-2,4-dihydro-1H-pyrimidine?
The IUPAC name of 3-(2-naphthalen-2-ylethyl)-6-[3-(trifluoromethyl)phenyl]-2,4-dihydro-1H-pyrimidine (CID 67843489) is 3-(2-naphthalen-2-ylethyl)-6-[3-(trifluoromethyl)phenyl]-2,4-dihydro-1H-pyrimidine.
What is the SMILES notation for 3-(2-naphthalen-2-ylethyl)-6-[3-(trifluoromethyl)phenyl]-2,4-dihydro-1H-pyrimidine?
The canonical SMILES for 3-(2-naphthalen-2-ylethyl)-6-[3-(trifluoromethyl)phenyl]-2,4-dihydro-1H-pyrimidine is FC(F)(F)c1cccc(C2=CCN(CCc3ccc4ccccc4c3)CN2)c1.
What is the InChIKey of 3-(2-naphthalen-2-ylethyl)-6-[3-(trifluoromethyl)phenyl]-2,4-dihydro-1H-pyrimidine?
The InChIKey is UQLOCJZTBVIVPV-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H21F3N2/c24-23(25,26)21-7-3-6-20(15-21)22-11-13-28(16-27-22)12-10-17-8-9-18-4-1-2-5-19(18)14-17/h1-9,11,14-15,27H,10,12-13,16H2.
What are the key properties of 3-(2-naphthalen-2-ylethyl)-6-[3-(trifluoromethyl)phenyl]-2,4-dihydro-1H-pyrimidine?
3-(2-naphthalen-2-ylethyl)-6-[3-(trifluoromethyl)phenyl]-2,4-dihydro-1H-pyrimidine has a molecular weight of 382.43 g/mol, XLogP of 5.30, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-naphthalen-2-ylethyl)-6-[3-(trifluoromethyl)phenyl]-2,4-dihydro-1H-pyrimidine is sourced from PubChem (CID 67843489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).