C12H17N2O2+ — CID 67843540
4-(1,2,3,4-tetrahydro-1,7-naphthyridin-7-ium-7-yl)butanoic acid (PubChem CID 67843540) has the molecular formula C12H17N2O2+ and a molecular weight of 221.28 g/mol. Its IUPAC name is 4-(1,2,3,4-tetrahydro-1,7-naphthyridin-7-ium-7-yl)butanoic acid.
| Compound Name | 4-(1,2,3,4-tetrahydro-1,7-naphthyridin-7-ium-7-yl)butanoic acid |
|---|---|
| PubChem CID | 67843540 |
| Molecular Formula | C12H17N2O2+ |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.13 |
| IUPAC Name | 4-(1,2,3,4-tetrahydro-1,7-naphthyridin-7-ium-7-yl)butanoic acid |
| SMILES | O=C(O)CCC[n+]1ccc2c(c1)NCCC2 |
| InChI | InChI=1S/C12H16N2O2/c15-12(16)4-2-7-14-8-5-10-3-1-6-13-11(10)9-14/h5,8-9,13H,1-4,6-7H2/p+1 |
| InChIKey | DNBGSVKUVAXMEQ-UHFFFAOYSA-O |
| XLogP | 1.20 |
| TPSA | 53.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|