About 2-benzyl-2-[(2-benzyl-3,4-dihydropyran-2-yl)oxy]-3,4-dihydropyran
2-benzyl-2-[(2-benzyl-3,4-dihydropyran-2-yl)oxy]-3,4-dihydropyran (PubChem CID 67843739) has the molecular formula C24H26O3
and a molecular weight of 362.47 g/mol. Its IUPAC name is 2-benzyl-2-[(2-benzyl-3,4-dihydropyran-2-yl)oxy]-3,4-dihydropyran.
Molecular Properties
| Compound Name | 2-benzyl-2-[(2-benzyl-3,4-dihydropyran-2-yl)oxy]-3,4-dihydropyran |
| PubChem CID | 67843739 |
| Molecular Formula | C24H26O3 |
| Molecular Weight | 362.47 g/mol |
| Exact Mass | 362.19 |
| IUPAC Name | 2-benzyl-2-[(2-benzyl-3,4-dihydropyran-2-yl)oxy]-3,4-dihydropyran |
| SMILES | C1=COC(Cc2ccccc2)(OC2(Cc3ccccc3)CCC=CO2)CC1 |
| InChI | InChI=1S/C24H26O3/c1-3-11-21(12-4-1)19-23(15-7-9-17-25-23)27-24(16-8-10-18-26-24)20-22-13-5-2-6-14-22/h1-6,9-14,17-18H,7-8,15-16,19-20H2 |
| InChIKey | CKBKHXHYBMMINP-UHFFFAOYSA-N |
| XLogP | 5.53 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.47 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-benzyl-2-[(2-benzyl-3,4-dihydropyran-2-yl)oxy]-3,4-dihydropyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzyl-2-[(2-benzyl-3,4-dihydropyran-2-yl)oxy]-3,4-dihydropyran?
The IUPAC name of 2-benzyl-2-[(2-benzyl-3,4-dihydropyran-2-yl)oxy]-3,4-dihydropyran (CID 67843739) is 2-benzyl-2-[(2-benzyl-3,4-dihydropyran-2-yl)oxy]-3,4-dihydropyran.
What is the SMILES notation for 2-benzyl-2-[(2-benzyl-3,4-dihydropyran-2-yl)oxy]-3,4-dihydropyran?
The canonical SMILES for 2-benzyl-2-[(2-benzyl-3,4-dihydropyran-2-yl)oxy]-3,4-dihydropyran is C1=COC(Cc2ccccc2)(OC2(Cc3ccccc3)CCC=CO2)CC1.
What is the InChIKey of 2-benzyl-2-[(2-benzyl-3,4-dihydropyran-2-yl)oxy]-3,4-dihydropyran?
The InChIKey is CKBKHXHYBMMINP-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H26O3/c1-3-11-21(12-4-1)19-23(15-7-9-17-25-23)27-24(16-8-10-18-26-24)20-22-13-5-2-6-14-22/h1-6,9-14,17-18H,7-8,15-16,19-20H2.
What are the key properties of 2-benzyl-2-[(2-benzyl-3,4-dihydropyran-2-yl)oxy]-3,4-dihydropyran?
2-benzyl-2-[(2-benzyl-3,4-dihydropyran-2-yl)oxy]-3,4-dihydropyran has a molecular weight of 362.47 g/mol, XLogP of 5.53, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzyl-2-[(2-benzyl-3,4-dihydropyran-2-yl)oxy]-3,4-dihydropyran is sourced from PubChem (CID 67843739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).