C22H26Cl2N2O2 — CID 67843802
8-chloro-1-[(3,4-dimethoxyphenyl)methyl]-6-ethyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride (PubChem CID 67843802) has the molecular formula C22H26Cl2N2O2 and a molecular weight of 421.37 g/mol. Its IUPAC name is 8-chloro-1-[(3,4-dimethoxyphenyl)methyl]-6-ethyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride.
| Compound Name | 8-chloro-1-[(3,4-dimethoxyphenyl)methyl]-6-ethyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride |
|---|---|
| PubChem CID | 67843802 |
| Molecular Formula | C22H26Cl2N2O2 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | 8-chloro-1-[(3,4-dimethoxyphenyl)methyl]-6-ethyl-2,3,4,9-tetrahydro-1H-pyrido[3,4-b]indole;hydrochloride |
| SMILES | CCc1cc(Cl)c2[nH]c3c(c2c1)CCNC3Cc1ccc(OC)c(OC)c1.Cl |
| InChI | InChI=1S/C22H25ClN2O2.ClH/c1-4-13-9-16-15-7-8-24-18(22(15)25-21(16)17(23)10-13)11-14-5-6-19(26-2)20(12-14)27-3;/h5-6,9-10,12,18,24-25H,4,7-8,11H2,1-3H3;1H |
| InChIKey | NZUIXZQKIMJLGX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|